C15H25N3O4 — CID 146119883
(3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyethyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119883) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyethyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyethyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119883 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-N-(2-methoxyethyl)-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | COCCNC(=O)N1C[C@@H]2[C@H](OCC3CC3)C(=O)N(C)[C@@H]2C1 |
| InChI | InChI=1S/C15H25N3O4/c1-17-12-8-18(15(20)16-5-6-21-2)7-11(12)13(14(17)19)22-9-10-3-4-10/h10-13H,3-9H2,1-2H3,(H,16,20)/t11-,12+,13-/m0/s1 |
| InChIKey | ZUQDFROMDIEKCS-XQQFMLRXSA-N |
| XLogP | -0.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|