C14H23N3O3 — CID 146119890
(3S,3aS,6aS)-N-cyclopentyl-3-methoxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119890) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3S,3aS,6aS)-N-cyclopentyl-3-methoxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-N-cyclopentyl-3-methoxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119890 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (3S,3aS,6aS)-N-cyclopentyl-3-methoxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | CO[C@@H]1C(=O)N(C)[C@@H]2CN(C(=O)NC3CCCC3)C[C@H]12 |
| InChI | InChI=1S/C14H23N3O3/c1-16-11-8-17(7-10(11)12(20-2)13(16)18)14(19)15-9-5-3-4-6-9/h9-12H,3-8H2,1-2H3,(H,15,19)/t10-,11+,12-/m0/s1 |
| InChIKey | FOYGHZVOABOSRA-TUAOUCFPSA-N |
| XLogP | 0.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |