C16H15FN2O4 — CID 146120443
[(3S,3aS,9bR)-8-fluoro-3-(hydroxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-(1,3-oxazol-5-yl)methanone (PubChem CID 146120443) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is [(3S,3aS,9bR)-8-fluoro-3-(hydroxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-(1,3-oxazol-5-yl)methanone.
| Compound Name | [(3S,3aS,9bR)-8-fluoro-3-(hydroxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 146120443 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(3S,3aS,9bR)-8-fluoro-3-(hydroxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1C[C@@H](CO)[C@@H]2COc3ccc(F)cc3[C@@H]21 |
| InChI | InChI=1S/C16H15FN2O4/c17-10-1-2-13-11(3-10)15-12(7-22-13)9(6-20)5-19(15)16(21)14-4-18-8-23-14/h1-4,8-9,12,15,20H,5-7H2/t9-,12-,15-/m0/s1 |
| InChIKey | BOVGACOAIJBILW-FMSQNYNMSA-N |
| XLogP | 1.63 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |