C20H22FNO4S — CID 146120452
[(3S,3aS,9bR)-8-fluoro-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol (PubChem CID 146120452) has the molecular formula C20H22FNO4S and a molecular weight of 391.46 g/mol. Its IUPAC name is [(3S,3aS,9bR)-8-fluoro-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,9bR)-8-fluoro-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 146120452 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(3S,3aS,9bR)-8-fluoro-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc(CN2C[C@@H](CO)[C@@H]3COc4ccc(F)cc4[C@@H]32)cc1 |
| InChI | InChI=1S/C20H22FNO4S/c1-27(24,25)16-5-2-13(3-6-16)9-22-10-14(11-23)18-12-26-19-7-4-15(21)8-17(19)20(18)22/h2-8,14,18,20,23H,9-12H2,1H3/t14-,18-,20-/m0/s1 |
| InChIKey | YZPHVZGQRBYFHE-DCPHZVHLSA-N |
| XLogP | 2.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |