C19H19F2NO2 — CID 146120466
[(3S,3aS,9bR)-1-[(3,5-difluorophenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol (PubChem CID 146120466) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is [(3S,3aS,9bR)-1-[(3,5-difluorophenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,9bR)-1-[(3,5-difluorophenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 146120466 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(3S,3aS,9bR)-1-[(3,5-difluorophenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
| SMILES | OC[C@@H]1CN(Cc2cc(F)cc(F)c2)[C@H]2c3ccccc3OC[C@@H]12 |
| InChI | InChI=1S/C19H19F2NO2/c20-14-5-12(6-15(21)7-14)8-22-9-13(10-23)17-11-24-18-4-2-1-3-16(18)19(17)22/h1-7,13,17,19,23H,8-11H2/t13-,17-,19-/m0/s1 |
| InChIKey | OBVRRFVKJDOAEG-IXDGSTSKSA-N |
| XLogP | 3.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |