C8H5N3O3S — CID 14612053
5-nitrothieno[2,3-b]pyridine-6-carboxamide (PubChem CID 14612053) has the molecular formula C8H5N3O3S and a molecular weight of 223.21 g/mol. Its IUPAC name is 5-nitrothieno[2,3-b]pyridine-6-carboxamide.
| Compound Name | 5-nitrothieno[2,3-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 14612053 |
| Molecular Formula | C8H5N3O3S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 5-nitrothieno[2,3-b]pyridine-6-carboxamide |
| SMILES | NC(=O)c1nc2sccc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5N3O3S/c9-7(12)6-5(11(13)14)3-4-1-2-15-8(4)10-6/h1-3H,(H2,9,12) |
| InChIKey | LVIIKGWQYHXSPJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|