C19H20FNO4S — CID 146120548
(3S,3aS,9bR)-1-(3-fluorophenyl)sulfonyl-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole (PubChem CID 146120548) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is (3S,3aS,9bR)-1-(3-fluorophenyl)sulfonyl-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole.
| Compound Name | (3S,3aS,9bR)-1-(3-fluorophenyl)sulfonyl-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole |
|---|---|
| PubChem CID | 146120548 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (3S,3aS,9bR)-1-(3-fluorophenyl)sulfonyl-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole |
| SMILES | COC[C@@H]1CN(S(=O)(=O)c2cccc(F)c2)[C@H]2c3ccccc3OC[C@@H]12 |
| InChI | InChI=1S/C19H20FNO4S/c1-24-11-13-10-21(26(22,23)15-6-4-5-14(20)9-15)19-16-7-2-3-8-18(16)25-12-17(13)19/h2-9,13,17,19H,10-12H2,1H3/t13-,17-,19-/m0/s1 |
| InChIKey | VLNOBFUCDYLTEG-IXDGSTSKSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |