C23H25ClN2O3 — CID 146120561
(3S,3aS,9bR)-N-(2-chlorophenyl)-3-(cyclopropylmethoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide (PubChem CID 146120561) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (3S,3aS,9bR)-N-(2-chlorophenyl)-3-(cyclopropylmethoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,9bR)-N-(2-chlorophenyl)-3-(cyclopropylmethoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 146120561 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3S,3aS,9bR)-N-(2-chlorophenyl)-3-(cyclopropylmethoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)N1C[C@@H](COCC2CC2)[C@@H]2COc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C23H25ClN2O3/c24-19-6-2-3-7-20(19)25-23(27)26-11-16(13-28-12-15-9-10-15)18-14-29-21-8-4-1-5-17(21)22(18)26/h1-8,15-16,18,22H,9-14H2,(H,25,27)/t16-,18-,22-/m0/s1 |
| InChIKey | QYZIPDIZLUXMMS-ZJBJCVSYSA-N |
| XLogP | 4.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |