C21H24FNO4S — CID 146120702
(3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole (PubChem CID 146120702) has the molecular formula C21H24FNO4S and a molecular weight of 405.49 g/mol. Its IUPAC name is (3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole.
| Compound Name | (3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole |
|---|---|
| PubChem CID | 146120702 |
| Molecular Formula | C21H24FNO4S |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole |
| SMILES | COC[C@@H]1CN(Cc2ccc(S(C)(=O)=O)cc2)[C@H]2c3cc(F)ccc3OC[C@@H]12 |
| InChI | InChI=1S/C21H24FNO4S/c1-26-12-15-11-23(10-14-3-6-17(7-4-14)28(2,24)25)21-18-9-16(22)5-8-20(18)27-13-19(15)21/h3-9,15,19,21H,10-13H2,1-2H3/t15-,19-,21-/m0/s1 |
| InChIKey | XDQQPBPTFTULSJ-ZRCAFCQKSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |