C15H17NO6S — CID 146121445
2-[4-[methyl-[(2-methylfuran-3-yl)methyl]sulfamoyl]phenoxy]acetic acid (PubChem CID 146121445) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[4-[methyl-[(2-methylfuran-3-yl)methyl]sulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[methyl-[(2-methylfuran-3-yl)methyl]sulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 146121445 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[4-[methyl-[(2-methylfuran-3-yl)methyl]sulfamoyl]phenoxy]acetic acid |
| SMILES | Cc1occc1CN(C)S(=O)(=O)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C15H17NO6S/c1-11-12(7-8-21-11)9-16(2)23(19,20)14-5-3-13(4-6-14)22-10-15(17)18/h3-8H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | GCMGAOHSAFRKIT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |