C23H22FN3O3 — CID 146122143
6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carbonyl]-2-phenylpyridazin-3-one (PubChem CID 146122143) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carbonyl]-2-phenylpyridazin-3-one.
| Compound Name | 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carbonyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 146122143 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidine-1-carbonyl]-2-phenylpyridazin-3-one |
| SMILES | O=C(c1ccc(=O)n(-c2ccccc2)n1)N1CCCC1CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O3/c24-17-10-8-16(9-11-17)21(28)15-19-7-4-14-26(19)23(30)20-12-13-22(29)27(25-20)18-5-2-1-3-6-18/h1-3,5-6,8-13,19,21,28H,4,7,14-15H2 |
| InChIKey | LPIKLDPSWCXMQA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |