C19H16N4O — CID 146122229
3-cyano-N-[2-(1-phenylpyrazol-3-yl)ethyl]benzamide (PubChem CID 146122229) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-cyano-N-[2-(1-phenylpyrazol-3-yl)ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-(1-phenylpyrazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146122229 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-cyano-N-[2-(1-phenylpyrazol-3-yl)ethyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCCc2ccn(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H16N4O/c20-14-15-5-4-6-16(13-15)19(24)21-11-9-17-10-12-23(22-17)18-7-2-1-3-8-18/h1-8,10,12-13H,9,11H2,(H,21,24) |
| InChIKey | DTYCLEMYXJYMGD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |