C16H10FNO2 — CID 14612226
6-fluoro-3a,11b-dihydrophenanthro[9,10-c]pyrrole-1,3-dione (PubChem CID 14612226) has the molecular formula C16H10FNO2 and a molecular weight of 267.26 g/mol. Its IUPAC name is 6-fluoro-3a,11b-dihydrophenanthro[9,10-c]pyrrole-1,3-dione.
| Compound Name | 6-fluoro-3a,11b-dihydrophenanthro[9,10-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 14612226 |
| Molecular Formula | C16H10FNO2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 6-fluoro-3a,11b-dihydrophenanthro[9,10-c]pyrrole-1,3-dione |
| SMILES | O=C1NC(=O)C2c3ccc(F)cc3-c3ccccc3C12 |
| InChI | InChI=1S/C16H10FNO2/c17-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13-14(11)16(20)18-15(13)19/h1-7,13-14H,(H,18,19,20) |
| InChIKey | IZICXNRILKJPJZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|