C18H18N2O2 — CID 146122582
N-[(3-hydroxyphenyl)methyl]-N,1-dimethylindole-4-carboxamide (PubChem CID 146122582) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(3-hydroxyphenyl)methyl]-N,1-dimethylindole-4-carboxamide.
| Compound Name | N-[(3-hydroxyphenyl)methyl]-N,1-dimethylindole-4-carboxamide |
|---|---|
| PubChem CID | 146122582 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(3-hydroxyphenyl)methyl]-N,1-dimethylindole-4-carboxamide |
| SMILES | CN(Cc1cccc(O)c1)C(=O)c1cccc2c1ccn2C |
| InChI | InChI=1S/C18H18N2O2/c1-19-10-9-15-16(7-4-8-17(15)19)18(22)20(2)12-13-5-3-6-14(21)11-13/h3-11,21H,12H2,1-2H3 |
| InChIKey | QMQIBMLXDWFRGF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |