C25H30N4O5 — CID 146124057
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate (PubChem CID 146124057) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146124057 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate |
| SMILES | CC(OC(=O)CN1C(=O)NC(C)(CCc2ccccc2)C1=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H30N4O5/c1-17(22(31)26-19-10-12-20(13-11-19)28(3)4)34-21(30)16-29-23(32)25(2,27-24(29)33)15-14-18-8-6-5-7-9-18/h5-13,17H,14-16H2,1-4H3,(H,26,31)(H,27,33) |
| InChIKey | LCGPIIVAPGPGHG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|