About N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide
N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 146124191) has the molecular formula C13H13Cl2N5O
and a molecular weight of 326.19 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide |
| PubChem CID | 146124191 |
| Molecular Formula | C13H13Cl2N5O |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)N(Cc1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C13H13Cl2N5O/c14-11-2-1-3-12(15)10(11)6-20(9-4-5-9)13(21)7-19-8-16-17-18-19/h1-3,8-9H,4-7H2 |
| InChIKey | YXRGDHOIALTGCO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide?
The IUPAC name of N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide (CID 146124191) is N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide.
What is the SMILES notation for N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide?
The canonical SMILES for N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide is O=C(Cn1cnnn1)N(Cc1c(Cl)cccc1Cl)C1CC1.
What is the InChIKey of N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide?
The InChIKey is YXRGDHOIALTGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2N5O/c14-11-2-1-3-12(15)10(11)6-20(9-4-5-9)13(21)7-19-8-16-17-18-19/h1-3,8-9H,4-7H2.
What are the key properties of N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide?
N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide has a molecular weight of 326.19 g/mol, XLogP of 2.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-[(2,6-dichlorophenyl)methyl]-2-(tetrazol-1-yl)acetamide is sourced from PubChem (CID 146124191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).