About (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride
(1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (PubChem CID 14612498) has the molecular formula C5H12Cl2N2
and a molecular weight of 171.07 g/mol. Its IUPAC name is (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride.
Molecular Properties
| Compound Name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| PubChem CID | 14612498 |
| Molecular Formula | C5H12Cl2N2 |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| SMILES | C1N[C@@H]2CN[C@H]1C2.Cl.Cl |
| InChI | InChI=1S/C5H10N2.2ClH/c1-4-2-6-5(1)3-7-4;;/h4-7H,1-3H2;2*1H/t4-,5-;;/m0../s1 |
| InChIKey | PIDOCGDMKRSJMT-RSLHMRQOSA-N |
| XLogP | 0.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The IUPAC name of (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CID 14612498) is (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride.
What is the SMILES notation for (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The canonical SMILES for (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride is C1N[C@@H]2CN[C@H]1C2.Cl.Cl.
What is the InChIKey of (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The InChIKey is PIDOCGDMKRSJMT-RSLHMRQOSA-N. The full InChI is InChI=1S/C5H10N2.2ClH/c1-4-2-6-5(1)3-7-4;;/h4-7H,1-3H2;2*1H/t4-,5-;;/m0../s1.
What are the key properties of (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
(1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride has a molecular weight of 171.07 g/mol, XLogP of 0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride is sourced from PubChem (CID 14612498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).