About [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine
[(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine (PubChem CID 14612509) has the molecular formula C5H11FN2
and a molecular weight of 118.16 g/mol. Its IUPAC name is [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine |
| PubChem CID | 14612509 |
| Molecular Formula | C5H11FN2 |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CNC[C@@H]1F |
| InChI | InChI=1S/C5H11FN2/c6-5-3-8-2-4(5)1-7/h4-5,8H,1-3,7H2/t4-,5+/m1/s1 |
| InChIKey | YSQMRDFLWLVLHV-UHNVWZDZSA-N |
| XLogP | -0.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine?
The IUPAC name of [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine (CID 14612509) is [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine.
What is the SMILES notation for [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine?
The canonical SMILES for [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine is NC[C@@H]1CNC[C@@H]1F.
What is the InChIKey of [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine?
The InChIKey is YSQMRDFLWLVLHV-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H11FN2/c6-5-3-8-2-4(5)1-7/h4-5,8H,1-3,7H2/t4-,5+/m1/s1.
What are the key properties of [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine?
[(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine has a molecular weight of 118.16 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-fluoropyrrolidin-3-yl]methanamine is sourced from PubChem (CID 14612509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).