C17H15F3N4O4S — CID 146125475
1-[2-(benzenesulfonamido)ethyl]-3-[2-(trifluoromethyl)-1,3-benzoxazol-5-yl]urea (PubChem CID 146125475) has the molecular formula C17H15F3N4O4S and a molecular weight of 428.39 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-3-[2-(trifluoromethyl)-1,3-benzoxazol-5-yl]urea.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-3-[2-(trifluoromethyl)-1,3-benzoxazol-5-yl]urea |
|---|---|
| PubChem CID | 146125475 |
| Molecular Formula | C17H15F3N4O4S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-3-[2-(trifluoromethyl)-1,3-benzoxazol-5-yl]urea |
| SMILES | O=C(NCCNS(=O)(=O)c1ccccc1)Nc1ccc2oc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C17H15F3N4O4S/c18-17(19,20)15-24-13-10-11(6-7-14(13)28-15)23-16(25)21-8-9-22-29(26,27)12-4-2-1-3-5-12/h1-7,10,22H,8-9H2,(H2,21,23,25) |
| InChIKey | RVCTWZOXMMIRPR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|