About N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide
N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide (PubChem CID 146125500) has the molecular formula C11H13N3OS2
and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide |
| PubChem CID | 146125500 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide |
| SMILES | O=C(NC1CCCSC1)c1csc2cncn12 |
| InChI | InChI=1S/C11H13N3OS2/c15-11(13-8-2-1-3-16-5-8)9-6-17-10-4-12-7-14(9)10/h4,6-8H,1-3,5H2,(H,13,15) |
| InChIKey | XEDVGEPDMXAPFG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide?
The IUPAC name of N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide (CID 146125500) is N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide.
What is the SMILES notation for N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide?
The canonical SMILES for N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide is O=C(NC1CCCSC1)c1csc2cncn12.
What is the InChIKey of N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide?
The InChIKey is XEDVGEPDMXAPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS2/c15-11(13-8-2-1-3-16-5-8)9-6-17-10-4-12-7-14(9)10/h4,6-8H,1-3,5H2,(H,13,15).
What are the key properties of N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide?
N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide has a molecular weight of 267.38 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thian-3-yl)imidazo[5,1-b][1,3]thiazole-3-carboxamide is sourced from PubChem (CID 146125500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).