C27H22N2O4 — CID 146126774
2-[3-(spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-1'-carbonyl)phenyl]isoindole-1,3-dione (PubChem CID 146126774) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[3-(spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-1'-carbonyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-1'-carbonyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146126774 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[3-(spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-1'-carbonyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C(c1cccc(N2C(=O)c3ccccc3C2=O)c1)N1CCC2(CCc3ccccc3O2)C1 |
| InChI | InChI=1S/C27H22N2O4/c30-24(28-15-14-27(17-28)13-12-18-6-1-4-11-23(18)33-27)19-7-5-8-20(16-19)29-25(31)21-9-2-3-10-22(21)26(29)32/h1-11,16H,12-15,17H2 |
| InChIKey | QBRSZRFQYCCUGL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|