C28H27N5O2 — CID 146127382
1-methyl-6-[3-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]phenyl]-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 146127382) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 1-methyl-6-[3-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]phenyl]-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-methyl-6-[3-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]phenyl]-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 146127382 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-methyl-6-[3-[4-(2-methyl-1H-indol-3-yl)piperidine-1-carbonyl]phenyl]-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(C(=O)c2cccc(-c3cnc4[nH]c(=O)n(C)c4c3)c2)CC1 |
| InChI | InChI=1S/C28H27N5O2/c1-17-25(22-8-3-4-9-23(22)30-17)18-10-12-33(13-11-18)27(34)20-7-5-6-19(14-20)21-15-24-26(29-16-21)31-28(35)32(24)2/h3-9,14-16,18,30H,10-13H2,1-2H3,(H,29,31,35) |
| InChIKey | GCPBHQQDOWVRNT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|