About (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone
(1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone (PubChem CID 146128308) has the molecular formula C16H19ClN4O2
and a molecular weight of 334.81 g/mol. Its IUPAC name is (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
Molecular Properties
| Compound Name | (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| PubChem CID | 146128308 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cn(C(C)(C)C)nn2)c2cccc(Cl)c2O1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-10-8-20(13-7-5-6-11(17)14(13)23-10)15(22)12-9-21(19-18-12)16(2,3)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | YTJXONSKBZEYQE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The IUPAC name of (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone (CID 146128308) is (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
What is the SMILES notation for (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The canonical SMILES for (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone is CC1CN(C(=O)c2cn(C(C)(C)C)nn2)c2cccc(Cl)c2O1.
What is the InChIKey of (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The InChIKey is YTJXONSKBZEYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O2/c1-10-8-20(13-7-5-6-11(17)14(13)23-10)15(22)12-9-21(19-18-12)16(2,3)4/h5-7,9-10H,8H2,1-4H3.
What are the key properties of (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
(1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone has a molecular weight of 334.81 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyltriazol-4-yl)-(8-chloro-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone is sourced from PubChem (CID 146128308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).