About 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine
6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine (PubChem CID 146129502) has the molecular formula C15H28N6O
and a molecular weight of 308.43 g/mol. Its IUPAC name is 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine |
| PubChem CID | 146129502 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine |
| SMILES | CCCCNc1cc(N(C)CCN2CCOCC2)nc(N)n1 |
| InChI | InChI=1S/C15H28N6O/c1-3-4-5-17-13-12-14(19-15(16)18-13)20(2)6-7-21-8-10-22-11-9-21/h12H,3-11H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | WRCBSJVPCTUBIX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine?
The IUPAC name of 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine (CID 146129502) is 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine.
What is the SMILES notation for 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine?
The canonical SMILES for 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine is CCCCNc1cc(N(C)CCN2CCOCC2)nc(N)n1.
What is the InChIKey of 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine?
The InChIKey is WRCBSJVPCTUBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N6O/c1-3-4-5-17-13-12-14(19-15(16)18-13)20(2)6-7-21-8-10-22-11-9-21/h12H,3-11H2,1-2H3,(H3,16,17,18,19).
What are the key properties of 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine?
6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine has a molecular weight of 308.43 g/mol, XLogP of 1.04, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-butyl-4-N-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4,6-triamine is sourced from PubChem (CID 146129502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).