About methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate
methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate (PubChem CID 146130440) has the molecular formula C15H22N2O5S
and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate.
Molecular Properties
| Compound Name | methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate |
| PubChem CID | 146130440 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1NC[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C15H22N2O5S/c1-22-15(19)12-8-11(23(16,20)21)6-7-13(12)17-9-10-4-2-3-5-14(10)18/h6-8,10,14,17-18H,2-5,9H2,1H3,(H2,16,20,21)/t10-,14+/m1/s1 |
| InChIKey | YBAPKZCTLZGFEW-YGRLFVJLSA-N |
| XLogP | 1.08 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate?
The IUPAC name of methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate (CID 146130440) is methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate.
What is the SMILES notation for methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate?
The canonical SMILES for methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate is COC(=O)c1cc(S(N)(=O)=O)ccc1NC[C@H]1CCCC[C@@H]1O.
What is the InChIKey of methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate?
The InChIKey is YBAPKZCTLZGFEW-YGRLFVJLSA-N. The full InChI is InChI=1S/C15H22N2O5S/c1-22-15(19)12-8-11(23(16,20)21)6-7-13(12)17-9-10-4-2-3-5-14(10)18/h6-8,10,14,17-18H,2-5,9H2,1H3,(H2,16,20,21)/t10-,14+/m1/s1.
What are the key properties of methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate?
methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate has a molecular weight of 342.42 g/mol, XLogP of 1.08, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]-5-sulfamoylbenzoate is sourced from PubChem (CID 146130440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).