C19H23N5O2 — CID 146130699
3-[2-(4-isoquinolin-4-ylpiperazin-1-yl)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 146130699) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-[2-(4-isoquinolin-4-ylpiperazin-1-yl)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-isoquinolin-4-ylpiperazin-1-yl)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146130699 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[2-(4-isoquinolin-4-ylpiperazin-1-yl)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1NC(=O)N(CCN2CCN(c3cncc4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C19H23N5O2/c1-14-18(25)24(19(26)21-14)11-8-22-6-9-23(10-7-22)17-13-20-12-15-4-2-3-5-16(15)17/h2-5,12-14H,6-11H2,1H3,(H,21,26) |
| InChIKey | AIYQLDPUCVJQSV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|