C15H15N5O3 — CID 146131202
8-(2,3-dihydro-1-benzofuran-3-ylamino)-3,7-dimethylpurine-2,6-dione (PubChem CID 146131202) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 8-(2,3-dihydro-1-benzofuran-3-ylamino)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(2,3-dihydro-1-benzofuran-3-ylamino)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 146131202 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 8-(2,3-dihydro-1-benzofuran-3-ylamino)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NC2COc3ccccc32)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H15N5O3/c1-19-11-12(20(2)15(22)18-13(11)21)17-14(19)16-9-7-23-10-6-4-3-5-8(9)10/h3-6,9H,7H2,1-2H3,(H,16,17)(H,18,21,22) |
| InChIKey | QAONSYBDWMAXAN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |