C16H14FNO2 — CID 146132730
N-benzyl-5-fluoro-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 146132730) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is N-benzyl-5-fluoro-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-benzyl-5-fluoro-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 146132730 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-benzyl-5-fluoro-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C16H14FNO2/c17-13-6-7-14-12(8-13)9-15(20-14)16(19)18-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,18,19) |
| InChIKey | JZYBGHNXTHEEAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |