C17H14F3N5O2 — CID 146134043
1-[1-[7-(trifluoromethyl)quinolin-4-yl]pyrrolidin-3-yl]triazole-4-carboxylic acid (PubChem CID 146134043) has the molecular formula C17H14F3N5O2 and a molecular weight of 377.33 g/mol. Its IUPAC name is 1-[1-[7-(trifluoromethyl)quinolin-4-yl]pyrrolidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-[7-(trifluoromethyl)quinolin-4-yl]pyrrolidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146134043 |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-[1-[7-(trifluoromethyl)quinolin-4-yl]pyrrolidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CCN(c3ccnc4cc(C(F)(F)F)ccc34)C2)nn1 |
| InChI | InChI=1S/C17H14F3N5O2/c18-17(19,20)10-1-2-12-13(7-10)21-5-3-15(12)24-6-4-11(8-24)25-9-14(16(26)27)22-23-25/h1-3,5,7,9,11H,4,6,8H2,(H,26,27) |
| InChIKey | NKLITYPHDCRWFT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |