C15H26N2O5S — CID 146134409
1-[4-(propylsulfonylamino)piperidine-1-carbonyl]cyclopentane-1-carboxylic acid (PubChem CID 146134409) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-[4-(propylsulfonylamino)piperidine-1-carbonyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[4-(propylsulfonylamino)piperidine-1-carbonyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 146134409 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[4-(propylsulfonylamino)piperidine-1-carbonyl]cyclopentane-1-carboxylic acid |
| SMILES | CCCS(=O)(=O)NC1CCN(C(=O)C2(C(=O)O)CCCC2)CC1 |
| InChI | InChI=1S/C15H26N2O5S/c1-2-11-23(21,22)16-12-5-9-17(10-6-12)13(18)15(14(19)20)7-3-4-8-15/h12,16H,2-11H2,1H3,(H,19,20) |
| InChIKey | AJBFFQCISNBMFC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|