C17H21ClN4O2 — CID 146135008
2-[4-[2-[2-(3-chlorophenyl)piperidin-1-yl]ethyl]triazol-1-yl]acetic acid (PubChem CID 146135008) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[4-[2-[2-(3-chlorophenyl)piperidin-1-yl]ethyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-(3-chlorophenyl)piperidin-1-yl]ethyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 146135008 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[4-[2-[2-(3-chlorophenyl)piperidin-1-yl]ethyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CCN2CCCCC2c2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-14-5-3-4-13(10-14)16-6-1-2-8-21(16)9-7-15-11-22(20-19-15)12-17(23)24/h3-5,10-11,16H,1-2,6-9,12H2,(H,23,24) |
| InChIKey | RWKVSNYHRXVRHP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |