C11H13BrN4O2S — CID 146135501
N-[[1-(4-bromo-2-methylphenyl)triazol-4-yl]methyl]methanesulfonamide (PubChem CID 146135501) has the molecular formula C11H13BrN4O2S and a molecular weight of 345.22 g/mol. Its IUPAC name is N-[[1-(4-bromo-2-methylphenyl)triazol-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(4-bromo-2-methylphenyl)triazol-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 146135501 |
| Molecular Formula | C11H13BrN4O2S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-[[1-(4-bromo-2-methylphenyl)triazol-4-yl]methyl]methanesulfonamide |
| SMILES | Cc1cc(Br)ccc1-n1cc(CNS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C11H13BrN4O2S/c1-8-5-9(12)3-4-11(8)16-7-10(14-15-16)6-13-19(2,17)18/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | IKMNECFPAIBNLW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |