About 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide
1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide (PubChem CID 146136211) has the molecular formula C9H12F2N4O
and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide |
| PubChem CID | 146136211 |
| Molecular Formula | C9H12F2N4O |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CC2CCC(F)(F)C2)nn1 |
| InChI | InChI=1S/C9H12F2N4O/c10-9(11)2-1-6(3-9)4-15-5-7(8(12)16)13-14-15/h5-6H,1-4H2,(H2,12,16) |
| InChIKey | WYAVPILXGBBJSZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide?
The IUPAC name of 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide (CID 146136211) is 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide.
What is the SMILES notation for 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide?
The canonical SMILES for 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide is NC(=O)c1cn(CC2CCC(F)(F)C2)nn1.
What is the InChIKey of 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide?
The InChIKey is WYAVPILXGBBJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N4O/c10-9(11)2-1-6(3-9)4-15-5-7(8(12)16)13-14-15/h5-6H,1-4H2,(H2,12,16).
What are the key properties of 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide?
1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide has a molecular weight of 230.22 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-difluorocyclopentyl)methyl]triazole-4-carboxamide is sourced from PubChem (CID 146136211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).