About 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid
2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid (PubChem CID 146136433) has the molecular formula C15H16BrNO6
and a molecular weight of 386.20 g/mol. Its IUPAC name is 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid |
| PubChem CID | 146136433 |
| Molecular Formula | C15H16BrNO6 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)c1cc2c(cc1Br)OCO2)C1CCOCC1 |
| InChI | InChI=1S/C15H16BrNO6/c16-11-6-13-12(22-8-23-13)5-10(11)15(20)17(7-14(18)19)9-1-3-21-4-2-9/h5-6,9H,1-4,7-8H2,(H,18,19) |
| InChIKey | UNMYXUXYLCTUDT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid?
The IUPAC name of 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid (CID 146136433) is 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid.
What is the SMILES notation for 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid?
The canonical SMILES for 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid is O=C(O)CN(C(=O)c1cc2c(cc1Br)OCO2)C1CCOCC1.
What is the InChIKey of 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid?
The InChIKey is UNMYXUXYLCTUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO6/c16-11-6-13-12(22-8-23-13)5-10(11)15(20)17(7-14(18)19)9-1-3-21-4-2-9/h5-6,9H,1-4,7-8H2,(H,18,19).
What are the key properties of 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid?
2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid has a molecular weight of 386.20 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-bromo-1,3-benzodioxole-5-carbonyl)-(oxan-4-yl)amino]acetic acid is sourced from PubChem (CID 146136433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).