C15H18N4O3S — CID 146137217
9a-[[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-1,6,7,9-tetrahydro-[1,4]oxazino[3,4-c][1,4]oxazin-4-one (PubChem CID 146137217) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 9a-[[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-1,6,7,9-tetrahydro-[1,4]oxazino[3,4-c][1,4]oxazin-4-one.
| Compound Name | 9a-[[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-1,6,7,9-tetrahydro-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 146137217 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 9a-[[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-1,6,7,9-tetrahydro-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
| SMILES | Cc1csc2ncnc(NCC34COCCN3C(=O)COC4)c12 |
| InChI | InChI=1S/C15H18N4O3S/c1-10-5-23-14-12(10)13(17-9-18-14)16-6-15-7-21-3-2-19(15)11(20)4-22-8-15/h5,9H,2-4,6-8H2,1H3,(H,16,17,18) |
| InChIKey | JCDHPZQDBRDTEX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |