C20H28N4O — CID 146138623
N-(2-methylpropyl)-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 146138623) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2-methylpropyl)-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 146138623 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-(2-methylpropyl)-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CC(C)CN(Cc1n[nH]c2c1COCC2)C1CCCc2cccnc21 |
| InChI | InChI=1S/C20H28N4O/c1-14(2)11-24(12-18-16-13-25-10-8-17(16)22-23-18)19-7-3-5-15-6-4-9-21-20(15)19/h4,6,9,14,19H,3,5,7-8,10-13H2,1-2H3,(H,22,23) |
| InChIKey | BKYGLUVPYDJERN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |