C13H18FN5O2 — CID 146138702
9-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 146138702) has the molecular formula C13H18FN5O2 and a molecular weight of 295.32 g/mol. Its IUPAC name is 9-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146138702 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 9-[[1-(2-fluoroethyl)pyrazol-4-yl]methyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(Cc3cnn(CCF)c3)C2)N1 |
| InChI | InChI=1S/C13H18FN5O2/c14-3-5-19-8-10(6-15-19)7-18-4-1-2-13(9-18)11(20)16-12(21)17-13/h6,8H,1-5,7,9H2,(H2,16,17,20,21) |
| InChIKey | SIJVQWGLKCHDKS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|