About 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane
3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane (PubChem CID 14613935) has the molecular formula C9H12N4O6
and a molecular weight of 272.22 g/mol. Its IUPAC name is 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane |
| PubChem CID | 14613935 |
| Molecular Formula | C9H12N4O6 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane |
| SMILES | O=[N+]([O-])C12CN3CC([N+](=O)[O-])(C1)CC([N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C9H12N4O6/c14-11(15)7-1-8(12(16)17)3-9(2-7,13(18)19)6-10(4-7)5-8/h1-6H2 |
| InChIKey | WJVZACMXAFMMDW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane?
The IUPAC name of 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane (CID 14613935) is 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane is O=[N+]([O-])C12CN3CC([N+](=O)[O-])(C1)CC([N+](=O)[O-])(C3)C2.
What is the InChIKey of 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane?
The InChIKey is WJVZACMXAFMMDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O6/c14-11(15)7-1-8(12(16)17)3-9(2-7,13(18)19)6-10(4-7)5-8/h1-6H2.
What are the key properties of 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane?
3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane has a molecular weight of 272.22 g/mol, XLogP of -0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trinitro-1-azatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 14613935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).