About 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one
4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one (PubChem CID 146139434) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one |
| PubChem CID | 146139434 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(CNC2C(=O)NCC2(C)C)cc1=O |
| InChI | InChI=1S/C13H19N3O2/c1-13(2)8-15-12(18)11(13)14-7-9-4-5-16(3)10(17)6-9/h4-6,11,14H,7-8H2,1-3H3,(H,15,18) |
| InChIKey | OFJJBALPFRKDHI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one?
The IUPAC name of 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one (CID 146139434) is 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one.
What is the SMILES notation for 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one?
The canonical SMILES for 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one is Cn1ccc(CNC2C(=O)NCC2(C)C)cc1=O.
What is the InChIKey of 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one?
The InChIKey is OFJJBALPFRKDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-13(2)8-15-12(18)11(13)14-7-9-4-5-16(3)10(17)6-9/h4-6,11,14H,7-8H2,1-3H3,(H,15,18).
What are the key properties of 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one?
4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one has a molecular weight of 249.31 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4,4-dimethyl-2-oxopyrrolidin-3-yl)amino]methyl]-1-methylpyridin-2-one is sourced from PubChem (CID 146139434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).