C14H17NO3 — CID 146139971
1-[3-(hydroxymethyl)-3-methylazetidin-1-yl]-2-(3-methylphenyl)ethane-1,2-dione (PubChem CID 146139971) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)-3-methylazetidin-1-yl]-2-(3-methylphenyl)ethane-1,2-dione.
| Compound Name | 1-[3-(hydroxymethyl)-3-methylazetidin-1-yl]-2-(3-methylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 146139971 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-[3-(hydroxymethyl)-3-methylazetidin-1-yl]-2-(3-methylphenyl)ethane-1,2-dione |
| SMILES | Cc1cccc(C(=O)C(=O)N2CC(C)(CO)C2)c1 |
| InChI | InChI=1S/C14H17NO3/c1-10-4-3-5-11(6-10)12(17)13(18)15-7-14(2,8-15)9-16/h3-6,16H,7-9H2,1-2H3 |
| InChIKey | ZIGSBYOJVVCPFK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|