C13H15F3N4O2S — CID 146140529
3-methyl-8-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 146140529) has the molecular formula C13H15F3N4O2S and a molecular weight of 348.35 g/mol. Its IUPAC name is 3-methyl-8-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-methyl-8-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146140529 |
| Molecular Formula | C13H15F3N4O2S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-methyl-8-[[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)NC2(CCN(Cc3csc(C(F)(F)F)n3)CC2)C1=O |
| InChI | InChI=1S/C13H15F3N4O2S/c1-19-10(21)12(18-11(19)22)2-4-20(5-3-12)6-8-7-23-9(17-8)13(14,15)16/h7H,2-6H2,1H3,(H,18,22) |
| InChIKey | VDRBEKBHSXJXLO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|