About 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine
7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 146140749) has the molecular formula C16H15FN4OS
and a molecular weight of 330.39 g/mol. Its IUPAC name is 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 146140749 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | Fc1ccc(OC[C@@H]2CCCN2c2ncnc3scnc23)cc1 |
| InChI | InChI=1S/C16H15FN4OS/c17-11-3-5-13(6-4-11)22-8-12-2-1-7-21(12)15-14-16(19-9-18-15)23-10-20-14/h3-6,9-10,12H,1-2,7-8H2/t12-/m0/s1 |
| InChIKey | AOHZNQFKZGFVEB-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine (CID 146140749) is 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine is Fc1ccc(OC[C@@H]2CCCN2c2ncnc3scnc23)cc1.
What is the InChIKey of 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is AOHZNQFKZGFVEB-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H15FN4OS/c17-11-3-5-13(6-4-11)22-8-12-2-1-7-21(12)15-14-16(19-9-18-15)23-10-20-14/h3-6,9-10,12H,1-2,7-8H2/t12-/m0/s1.
What are the key properties of 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine?
7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 330.39 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2S)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 146140749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).