C17H26N4O — CID 146141193
N-(1-oxaspiro[4.4]nonan-4-yl)-1-pyridazin-3-ylpiperidin-4-amine (PubChem CID 146141193) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(1-oxaspiro[4.4]nonan-4-yl)-1-pyridazin-3-ylpiperidin-4-amine.
| Compound Name | N-(1-oxaspiro[4.4]nonan-4-yl)-1-pyridazin-3-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 146141193 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-(1-oxaspiro[4.4]nonan-4-yl)-1-pyridazin-3-ylpiperidin-4-amine |
| SMILES | c1cnnc(N2CCC(NC3CCOC34CCCC4)CC2)c1 |
| InChI | InChI=1S/C17H26N4O/c1-2-9-17(8-1)15(7-13-22-17)19-14-5-11-21(12-6-14)16-4-3-10-18-20-16/h3-4,10,14-15,19H,1-2,5-9,11-13H2 |
| InChIKey | KOCKLRMWYIIERS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |