C10H10F3N5O2S — CID 146141244
1-methyl-N-(5-methylpyrazin-2-yl)-4-(trifluoromethyl)pyrazole-5-sulfonamide (PubChem CID 146141244) has the molecular formula C10H10F3N5O2S and a molecular weight of 321.28 g/mol. Its IUPAC name is 1-methyl-N-(5-methylpyrazin-2-yl)-4-(trifluoromethyl)pyrazole-5-sulfonamide.
| Compound Name | 1-methyl-N-(5-methylpyrazin-2-yl)-4-(trifluoromethyl)pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 146141244 |
| Molecular Formula | C10H10F3N5O2S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-methyl-N-(5-methylpyrazin-2-yl)-4-(trifluoromethyl)pyrazole-5-sulfonamide |
| SMILES | Cc1cnc(NS(=O)(=O)c2c(C(F)(F)F)cnn2C)cn1 |
| InChI | InChI=1S/C10H10F3N5O2S/c1-6-3-15-8(5-14-6)17-21(19,20)9-7(10(11,12)13)4-16-18(9)2/h3-5H,1-2H3,(H,15,17) |
| InChIKey | HGGSTIJHWMHJSD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |