About (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone
(7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone (PubChem CID 146141522) has the molecular formula C15H13ClFN3O2
and a molecular weight of 321.74 g/mol. Its IUPAC name is (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone.
Molecular Properties
| Compound Name | (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone |
| PubChem CID | 146141522 |
| Molecular Formula | C15H13ClFN3O2 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCCc3ccc(Cl)c(F)c32)ncn1 |
| InChI | InChI=1S/C15H13ClFN3O2/c1-22-12-7-11(18-8-19-12)15(21)20-6-2-3-9-4-5-10(16)13(17)14(9)20/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | ZVDRIVWXKNCBCF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone?
The IUPAC name of (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone (CID 146141522) is (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone.
What is the SMILES notation for (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone?
The canonical SMILES for (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone is COc1cc(C(=O)N2CCCc3ccc(Cl)c(F)c32)ncn1.
What is the InChIKey of (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone?
The InChIKey is ZVDRIVWXKNCBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClFN3O2/c1-22-12-7-11(18-8-19-12)15(21)20-6-2-3-9-4-5-10(16)13(17)14(9)20/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone?
(7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone has a molecular weight of 321.74 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-(6-methoxypyrimidin-4-yl)methanone is sourced from PubChem (CID 146141522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).