About N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide
N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 146141556) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide |
| PubChem CID | 146141556 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ocnc1C(=O)NC1(C)CCOc2ccccc21 |
| InChI | InChI=1S/C17H20N2O3/c1-11(2)15-14(18-10-22-15)16(20)19-17(3)8-9-21-13-7-5-4-6-12(13)17/h4-7,10-11H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | YWWUVVBOGSMEOV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide (CID 146141556) is N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide is CC(C)c1ocnc1C(=O)NC1(C)CCOc2ccccc21.
What is the InChIKey of N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide?
The InChIKey is YWWUVVBOGSMEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-11(2)15-14(18-10-22-15)16(20)19-17(3)8-9-21-13-7-5-4-6-12(13)17/h4-7,10-11H,8-9H2,1-3H3,(H,19,20).
What are the key properties of N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide?
N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide has a molecular weight of 300.36 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-2,3-dihydrochromen-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 146141556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).