C19H26N2O4 — CID 146141590
3-[cyclopropylmethyl-[(4-methylmorpholin-2-yl)methyl]carbamoyl]-4-methylbenzoic acid (PubChem CID 146141590) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-[(4-methylmorpholin-2-yl)methyl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[cyclopropylmethyl-[(4-methylmorpholin-2-yl)methyl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 146141590 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[cyclopropylmethyl-[(4-methylmorpholin-2-yl)methyl]carbamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)N(CC1CC1)CC1CN(C)CCO1 |
| InChI | InChI=1S/C19H26N2O4/c1-13-3-6-15(19(23)24)9-17(13)18(22)21(10-14-4-5-14)12-16-11-20(2)7-8-25-16/h3,6,9,14,16H,4-5,7-8,10-12H2,1-2H3,(H,23,24) |
| InChIKey | OBKYRAUZNKFNAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |