C15H16FNO4 — CID 146141826
methyl (E)-4-[(7-fluoro-3,4-dihydro-2H-chromene-3-carbonyl)amino]but-2-enoate (PubChem CID 146141826) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is methyl (E)-4-[(7-fluoro-3,4-dihydro-2H-chromene-3-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(7-fluoro-3,4-dihydro-2H-chromene-3-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 146141826 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methyl (E)-4-[(7-fluoro-3,4-dihydro-2H-chromene-3-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1COc2cc(F)ccc2C1 |
| InChI | InChI=1S/C15H16FNO4/c1-20-14(18)3-2-6-17-15(19)11-7-10-4-5-12(16)8-13(10)21-9-11/h2-5,8,11H,6-7,9H2,1H3,(H,17,19)/b3-2+ |
| InChIKey | OCUZDZGUEGPOJT-NSCUHMNNSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|