About 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate
2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate (PubChem CID 146142443) has the molecular formula C17H24FN3O3
and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate |
| PubChem CID | 146142443 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate |
| SMILES | O=C(OCCF)N1CCC(c2nccc(C3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C17H24FN3O3/c18-6-12-24-17(22)21-8-2-14(3-9-21)16-19-7-1-15(20-16)13-4-10-23-11-5-13/h1,7,13-14H,2-6,8-12H2 |
| InChIKey | JIWYSYIKCVTQAQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate?
The IUPAC name of 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate (CID 146142443) is 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate?
The canonical SMILES for 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate is O=C(OCCF)N1CCC(c2nccc(C3CCOCC3)n2)CC1.
What is the InChIKey of 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate?
The InChIKey is JIWYSYIKCVTQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FN3O3/c18-6-12-24-17(22)21-8-2-14(3-9-21)16-19-7-1-15(20-16)13-4-10-23-11-5-13/h1,7,13-14H,2-6,8-12H2.
What are the key properties of 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate?
2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate has a molecular weight of 337.40 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 4-[4-(oxan-4-yl)pyrimidin-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 146142443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).