About 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine
5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine (PubChem CID 146142726) has the molecular formula C10H12ClN5
and a molecular weight of 237.69 g/mol. Its IUPAC name is 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine |
| PubChem CID | 146142726 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine |
| SMILES | Cc1nc(CNc2ncc(Cl)cn2)[nH]c1C |
| InChI | InChI=1S/C10H12ClN5/c1-6-7(2)16-9(15-6)5-14-10-12-3-8(11)4-13-10/h3-4H,5H2,1-2H3,(H,15,16)(H,12,13,14) |
| InChIKey | SBTMYCSMDAYENZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine?
The IUPAC name of 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine (CID 146142726) is 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine.
What is the SMILES notation for 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine?
The canonical SMILES for 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine is Cc1nc(CNc2ncc(Cl)cn2)[nH]c1C.
What is the InChIKey of 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine?
The InChIKey is SBTMYCSMDAYENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN5/c1-6-7(2)16-9(15-6)5-14-10-12-3-8(11)4-13-10/h3-4H,5H2,1-2H3,(H,15,16)(H,12,13,14).
What are the key properties of 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine?
5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine has a molecular weight of 237.69 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]pyrimidin-2-amine is sourced from PubChem (CID 146142726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).